C10H12ClNO3 — CID 103292136
methyl N-[(2-chloro-6-methoxyphenyl)methyl]carbamate (PubChem CID 103292136) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is methyl N-[(2-chloro-6-methoxyphenyl)methyl]carbamate.
| Compound Name | methyl N-[(2-chloro-6-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 103292136 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | methyl N-[(2-chloro-6-methoxyphenyl)methyl]carbamate |
| SMILES | COC(=O)NCc1c(Cl)cccc1OC |
| InChI | InChI=1S/C10H12ClNO3/c1-14-9-5-3-4-8(11)7(9)6-12-10(13)15-2/h3-5H,6H2,1-2H3,(H,12,13) |
| InChIKey | CQBCFVUOHNDRGL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |