C24H25NO3S — CID 28580089
N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-4-(phenylsulfanylmethyl)benzamide (PubChem CID 28580089) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-4-(phenylsulfanylmethyl)benzamide.
| Compound Name | N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-4-(phenylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 28580089 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-4-(phenylsulfanylmethyl)benzamide |
| SMILES | COc1ccc([C@H](C)NC(=O)c2ccc(CSc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C24H25NO3S/c1-17(20-13-14-22(27-2)23(15-20)28-3)25-24(26)19-11-9-18(10-12-19)16-29-21-7-5-4-6-8-21/h4-15,17H,16H2,1-3H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | DISRFOYZJNKWJR-KRWDZBQOSA-N |
| XLogP | 5.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |