C18H21NO5S — CID 27823905
N-[2-(2-methoxyphenoxy)ethyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 27823905) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 27823905 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | COc1ccccc1OCCNC(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-23-16-5-3-4-6-17(16)24-12-11-19-18(20)15-9-7-14(8-10-15)13-25(2,21)22/h3-10H,11-13H2,1-2H3,(H,19,20) |
| InChIKey | SWKDEXVHZVHLGN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|