C18H21NO3S2 — CID 26352356
4-(methylsulfonylmethyl)-N-(3-phenylsulfanylpropyl)benzamide (PubChem CID 26352356) has the molecular formula C18H21NO3S2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-N-(3-phenylsulfanylpropyl)benzamide.
| Compound Name | 4-(methylsulfonylmethyl)-N-(3-phenylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 26352356 |
| Molecular Formula | C18H21NO3S2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-(methylsulfonylmethyl)-N-(3-phenylsulfanylpropyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)NCCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO3S2/c1-24(21,22)14-15-8-10-16(11-9-15)18(20)19-12-5-13-23-17-6-3-2-4-7-17/h2-4,6-11H,5,12-14H2,1H3,(H,19,20) |
| InChIKey | ZXHGQGAWYLHVBO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|