C17H18ClNO3S2 — CID 32577044
2-chloro-5-methylsulfonyl-N-(3-phenylsulfanylpropyl)benzamide (PubChem CID 32577044) has the molecular formula C17H18ClNO3S2 and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-chloro-5-methylsulfonyl-N-(3-phenylsulfanylpropyl)benzamide.
| Compound Name | 2-chloro-5-methylsulfonyl-N-(3-phenylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 32577044 |
| Molecular Formula | C17H18ClNO3S2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-chloro-5-methylsulfonyl-N-(3-phenylsulfanylpropyl)benzamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)NCCCSc2ccccc2)c1 |
| InChI | InChI=1S/C17H18ClNO3S2/c1-24(21,22)14-8-9-16(18)15(12-14)17(20)19-10-5-11-23-13-6-3-2-4-7-13/h2-4,6-9,12H,5,10-11H2,1H3,(H,19,20) |
| InChIKey | VOCLFIBPWAAYKM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|