C17H18N2O3S2 — CID 27828924
5-methylsulfanyl-2-nitro-N-(3-phenylsulfanylpropyl)benzamide (PubChem CID 27828924) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 5-methylsulfanyl-2-nitro-N-(3-phenylsulfanylpropyl)benzamide.
| Compound Name | 5-methylsulfanyl-2-nitro-N-(3-phenylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 27828924 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 5-methylsulfanyl-2-nitro-N-(3-phenylsulfanylpropyl)benzamide |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)NCCCSc2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O3S2/c1-23-14-8-9-16(19(21)22)15(12-14)17(20)18-10-5-11-24-13-6-3-2-4-7-13/h2-4,6-9,12H,5,10-11H2,1H3,(H,18,20) |
| InChIKey | NTDHURQVMXOIMO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|