C13H15F3N2O4S — CID 86929022
5-methylsulfanyl-2-nitro-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide (PubChem CID 86929022) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is 5-methylsulfanyl-2-nitro-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide.
| Compound Name | 5-methylsulfanyl-2-nitro-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 86929022 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 5-methylsulfanyl-2-nitro-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)NCCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O4S/c1-23-9-3-4-11(18(20)21)10(7-9)12(19)17-5-2-6-22-8-13(14,15)16/h3-4,7H,2,5-6,8H2,1H3,(H,17,19) |
| InChIKey | YWNZLDCJXHSLFS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|