C17H15ClN2O3S2 — CID 78810749
N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-5-methylsulfonylbenzamide (PubChem CID 78810749) has the molecular formula C17H15ClN2O3S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-5-methylsulfonylbenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 78810749 |
| Molecular Formula | C17H15ClN2O3S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-chloro-5-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)NCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C17H15ClN2O3S2/c1-25(22,23)11-6-7-13(18)12(10-11)17(21)19-9-8-16-20-14-4-2-3-5-15(14)24-16/h2-7,10H,8-9H2,1H3,(H,19,21) |
| InChIKey | DYTVUWQXTLCJQY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |