C16H14N2O2S2 — CID 39996788
5-acetyl-N-[2-(1,3-benzothiazol-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 39996788) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-acetyl-N-[2-(1,3-benzothiazol-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[2-(1,3-benzothiazol-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 39996788 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 5-acetyl-N-[2-(1,3-benzothiazol-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)NCCc2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-10(19)12-6-7-14(21-12)16(20)17-9-8-15-18-11-4-2-3-5-13(11)22-15/h2-7H,8-9H2,1H3,(H,17,20) |
| InChIKey | IJGFWMRPTOVMOR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |