C22H24ClN3O3S2 — CID 46823827
3-(azepan-1-ylsulfonyl)-N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-chlorobenzamide (PubChem CID 46823827) has the molecular formula C22H24ClN3O3S2 and a molecular weight of 478.04 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-chlorobenzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 46823827 |
| Molecular Formula | C22H24ClN3O3S2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-chlorobenzamide |
| SMILES | O=C(NCCc1nc2ccccc2s1)c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C22H24ClN3O3S2/c23-17-10-9-16(15-20(17)31(28,29)26-13-5-1-2-6-14-26)22(27)24-12-11-21-25-18-7-3-4-8-19(18)30-21/h3-4,7-10,15H,1-2,5-6,11-14H2,(H,24,27) |
| InChIKey | JTMPIZDPLIKVTG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |