C21H22N2O4S2 — CID 2568292
1,3-benzothiazol-2-ylmethyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2568292) has the molecular formula C21H22N2O4S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2568292 |
| Molecular Formula | C21H22N2O4S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2nc3ccccc3s2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H22N2O4S2/c1-15-9-10-16(13-19(15)29(25,26)23-11-5-2-6-12-23)21(24)27-14-20-22-17-7-3-4-8-18(17)28-20/h3-4,7-10,13H,2,5-6,11-12,14H2,1H3 |
| InChIKey | AHWJHXCRQYJRSU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |