C20H19N3O4S — CID 3269746
1,3-benzothiazol-2-ylmethyl 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 3269746) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 3269746 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N3O4S/c24-20(27-13-19-21-15-6-2-3-7-18(15)28-19)14-8-9-16(17(12-14)23(25)26)22-10-4-1-5-11-22/h2-3,6-9,12H,1,4-5,10-11,13H2 |
| InChIKey | CBQRBOUPLVEMIC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|