C20H18N4O5S — CID 3339886
[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 3339886) has the molecular formula C20H18N4O5S and a molecular weight of 426.45 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 3339886 |
| Molecular Formula | C20H18N4O5S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H18N4O5S/c25-18(22-20-21-14-5-1-2-6-17(14)30-20)12-29-19(26)13-7-8-15(16(11-13)24(27)28)23-9-3-4-10-23/h1-2,5-8,11H,3-4,9-10,12H2,(H,21,22,25) |
| InChIKey | BWBLONDQLYESFI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|