C20H20FN3O5 — CID 9014197
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 9014197) has the molecular formula C20H20FN3O5 and a molecular weight of 401.39 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 9014197 |
| Molecular Formula | C20H20FN3O5 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)NCc1ccccc1F |
| InChI | InChI=1S/C20H20FN3O5/c21-16-6-2-1-5-15(16)12-22-19(25)13-29-20(26)14-7-8-17(18(11-14)24(27)28)23-9-3-4-10-23/h1-2,5-8,11H,3-4,9-10,12-13H2,(H,22,25) |
| InChIKey | NORNECWKNCYNOD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|