C16H18F3N3O5 — CID 7781958
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 7781958) has the molecular formula C16H18F3N3O5 and a molecular weight of 389.33 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 7781958 |
| Molecular Formula | C16H18F3N3O5 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)NCC(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O5/c17-16(18,19)10-20-14(23)9-27-15(24)11-4-5-12(13(8-11)22(25)26)21-6-2-1-3-7-21/h4-5,8H,1-3,6-7,9-10H2,(H,20,23) |
| InChIKey | LLCWDYFDMRNQDY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|