C20H21FN2O4 — CID 23797040
(4-fluorophenyl)methyl 4-(azepan-1-yl)-3-nitrobenzoate (PubChem CID 23797040) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 4-(azepan-1-yl)-3-nitrobenzoate.
| Compound Name | (4-fluorophenyl)methyl 4-(azepan-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 23797040 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (4-fluorophenyl)methyl 4-(azepan-1-yl)-3-nitrobenzoate |
| SMILES | O=C(OCc1ccc(F)cc1)c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21FN2O4/c21-17-8-5-15(6-9-17)14-27-20(24)16-7-10-18(19(13-16)23(25)26)22-11-3-1-2-4-12-22/h5-10,13H,1-4,11-12,14H2 |
| InChIKey | RKVRBPHICLQUDC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|