C19H19FN2O4 — CID 7857987
[(1S)-1-(4-fluorophenyl)ethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 7857987) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is [(1S)-1-(4-fluorophenyl)ethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | [(1S)-1-(4-fluorophenyl)ethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 7857987 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [(1S)-1-(4-fluorophenyl)ethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O4/c1-13(14-4-7-16(20)8-5-14)26-19(23)15-6-9-17(18(12-15)22(24)25)21-10-2-3-11-21/h4-9,12-13H,2-3,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | LAUWEPFNQGSWFN-ZDUSSCGKSA-N |
| XLogP | 4.25 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|