C16H19N3O4 — CID 7378803
[(1R)-1-cyanoethyl] 4-(azepan-1-yl)-3-nitrobenzoate (PubChem CID 7378803) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 4-(azepan-1-yl)-3-nitrobenzoate.
| Compound Name | [(1R)-1-cyanoethyl] 4-(azepan-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7378803 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [(1R)-1-cyanoethyl] 4-(azepan-1-yl)-3-nitrobenzoate |
| SMILES | C[C@H](C#N)OC(=O)c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N3O4/c1-12(11-17)23-16(20)13-6-7-14(15(10-13)19(21)22)18-8-4-2-3-5-9-18/h6-7,10,12H,2-5,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | WZXOEHMIIRSQOQ-GFCCVEGCSA-N |
| XLogP | 3.04 |
| TPSA | 96.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|