C25H27N3O6 — CID 42922140
[1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 42922140) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 42922140 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | CC(=O)N1CCc2cc(C(=O)C(C)OC(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)ccc21 |
| InChI | InChI=1S/C25H27N3O6/c1-16(24(30)19-6-8-21-18(14-19)10-13-27(21)17(2)29)34-25(31)20-7-9-22(23(15-20)28(32)33)26-11-4-3-5-12-26/h6-9,14-16H,3-5,10-13H2,1-2H3 |
| InChIKey | LERGGWKDQGOEMP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|