C34H38N4O8 — CID 23880101
[4-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]oxymethyl]phenyl]methyl 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 23880101) has the molecular formula C34H38N4O8 and a molecular weight of 630.70 g/mol. Its IUPAC name is [4-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]oxymethyl]phenyl]methyl 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [4-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]oxymethyl]phenyl]methyl 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 23880101 |
| Molecular Formula | C34H38N4O8 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | [4-[[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]oxymethyl]phenyl]methyl 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCN(c2ccc(C(=O)OCc3ccc(COC(=O)c4ccc(N5CCC(C)CC5)c([N+](=O)[O-])c4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C34H38N4O8/c1-23-11-15-35(16-12-23)29-9-7-27(19-31(29)37(41)42)33(39)45-21-25-3-5-26(6-4-25)22-46-34(40)28-8-10-30(32(20-28)38(43)44)36-17-13-24(2)14-18-36/h3-10,19-20,23-24H,11-18,21-22H2,1-2H3 |
| InChIKey | KSUMSMMBMFVISY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|