C27H24N2O6 — CID 3970399
(3-oxobenzo[f]chromen-1-yl)methyl 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 3970399) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 3970399 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCN(c2ccc(C(=O)OCc3cc(=O)oc4ccc5ccccc5c34)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H24N2O6/c1-17-10-12-28(13-11-17)22-8-6-19(14-23(22)29(32)33)27(31)34-16-20-15-25(30)35-24-9-7-18-4-2-3-5-21(18)26(20)24/h2-9,14-15,17H,10-13,16H2,1H3 |
| InChIKey | CQVQGZIKJRGUPD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|