About (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate
(3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate (PubChem CID 2628394) has the molecular formula C22H16O4
and a molecular weight of 344.37 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate.
Molecular Properties
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate |
| PubChem CID | 2628394 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2cc(=O)oc3ccc4ccccc4c23)cc1 |
| InChI | InChI=1S/C22H16O4/c1-14-6-8-16(9-7-14)22(24)25-13-17-12-20(23)26-19-11-10-15-4-2-3-5-18(15)21(17)19/h2-12H,13H2,1H3 |
| InChIKey | OPQOIMWOOQUPRB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate?
The IUPAC name of (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate (CID 2628394) is (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate.
What is the SMILES notation for (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate?
The canonical SMILES for (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate is Cc1ccc(C(=O)OCc2cc(=O)oc3ccc4ccccc4c23)cc1.
What is the InChIKey of (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate?
The InChIKey is OPQOIMWOOQUPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16O4/c1-14-6-8-16(9-7-14)22(24)25-13-17-12-20(23)26-19-11-10-15-4-2-3-5-18(15)21(17)19/h2-12H,13H2,1H3.
What are the key properties of (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate?
(3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate has a molecular weight of 344.37 g/mol, XLogP of 4.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxobenzo[f]chromen-1-yl)methyl 4-methylbenzoate is sourced from PubChem (CID 2628394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).