About (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate
(3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate (PubChem CID 3956996) has the molecular formula C21H13IO4
and a molecular weight of 456.24 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate.
Molecular Properties
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate |
| PubChem CID | 3956996 |
| Molecular Formula | C21H13IO4 |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate |
| SMILES | O=C(OCc1cc(=O)oc2ccc3ccccc3c12)c1cccc(I)c1 |
| InChI | InChI=1S/C21H13IO4/c22-16-6-3-5-14(10-16)21(24)25-12-15-11-19(23)26-18-9-8-13-4-1-2-7-17(13)20(15)18/h1-11H,12H2 |
| InChIKey | JMHAFNDXHHMOOP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate?
The IUPAC name of (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate (CID 3956996) is (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate.
What is the SMILES notation for (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate?
The canonical SMILES for (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate is O=C(OCc1cc(=O)oc2ccc3ccccc3c12)c1cccc(I)c1.
What is the InChIKey of (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate?
The InChIKey is JMHAFNDXHHMOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13IO4/c22-16-6-3-5-14(10-16)21(24)25-12-15-11-19(23)26-18-9-8-13-4-1-2-7-17(13)20(15)18/h1-11H,12H2.
What are the key properties of (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate?
(3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate has a molecular weight of 456.24 g/mol, XLogP of 4.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxobenzo[f]chromen-1-yl)methyl 3-iodobenzoate is sourced from PubChem (CID 3956996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).