C25H21NO6S — CID 2628448
(3-oxobenzo[f]chromen-1-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2628448) has the molecular formula C25H21NO6S and a molecular weight of 463.51 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2628448 |
| Molecular Formula | C25H21NO6S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cc(=O)oc2ccc3ccccc3c12)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C25H21NO6S/c27-23-15-19(24-21-9-2-1-6-17(21)10-11-22(24)32-23)16-31-25(28)18-7-5-8-20(14-18)33(29,30)26-12-3-4-13-26/h1-2,5-11,14-15H,3-4,12-13,16H2 |
| InChIKey | GRKVPBUINYDLPW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|