C19H18N2O5S — CID 9398340
1,3-benzoxazol-2-ylmethyl 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 9398340) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 9398340 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1nc2ccccc2o1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H18N2O5S/c22-19(25-13-18-20-16-8-1-2-9-17(16)26-18)14-6-5-7-15(12-14)27(23,24)21-10-3-4-11-21/h1-2,5-9,12H,3-4,10-11,13H2 |
| InChIKey | RSKUFIARXACSBW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |