C22H22N2O5S — CID 55476044
(3-phenyl-1,2-oxazol-5-yl)methyl 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 55476044) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55476044 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cc(-c2ccccc2)no1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H22N2O5S/c25-22(28-16-19-15-21(23-29-19)17-8-3-1-4-9-17)18-10-7-11-20(14-18)30(26,27)24-12-5-2-6-13-24/h1,3-4,7-11,14-15H,2,5-6,12-13,16H2 |
| InChIKey | STLLJGUNRGHQSD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |