C23H25N3O4S — CID 56529969
N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 56529969) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 56529969 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCc1ccc(-c2cc(NC(=O)c3cccc(S(=O)(=O)N4CCCCC4)c3)on2)cc1 |
| InChI | InChI=1S/C23H25N3O4S/c1-2-17-9-11-18(12-10-17)21-16-22(30-25-21)24-23(27)19-7-6-8-20(15-19)31(28,29)26-13-4-3-5-14-26/h6-12,15-16H,2-5,13-14H2,1H3,(H,24,27) |
| InChIKey | QFCLWWDXGVDSDQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |