C22H25NO5S — CID 2510979
[2-(4-ethylphenyl)-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2510979) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2510979 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CCc1ccc(C(=O)COC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H25NO5S/c1-2-17-9-11-18(12-10-17)21(24)16-28-22(25)19-7-6-8-20(15-19)29(26,27)23-13-4-3-5-14-23/h6-12,15H,2-5,13-14,16H2,1H3 |
| InChIKey | AAYUFUALNADRSC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |