C21H23NO5S — CID 2908186
phenacyl 3-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 2908186) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is phenacyl 3-(4-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | phenacyl 3-(4-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 2908186 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | phenacyl 3-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(C(=O)OCC(=O)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C21H23NO5S/c1-16-10-12-22(13-11-16)28(25,26)19-9-5-8-18(14-19)21(24)27-15-20(23)17-6-3-2-4-7-17/h2-9,14,16H,10-13,15H2,1H3 |
| InChIKey | PSLRTXCCPPGQRX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |