C21H22FNO5S — CID 7829746
[2-(4-fluorophenyl)-2-oxoethyl] 3-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 7829746) has the molecular formula C21H22FNO5S and a molecular weight of 419.47 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 3-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7829746 |
| Molecular Formula | C21H22FNO5S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | C[C@H]1CCCCN1S(=O)(=O)c1cccc(C(=O)OCC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H22FNO5S/c1-15-5-2-3-12-23(15)29(26,27)19-7-4-6-17(13-19)21(25)28-14-20(24)16-8-10-18(22)11-9-16/h4,6-11,13,15H,2-3,5,12,14H2,1H3/t15-/m0/s1 |
| InChIKey | CGPZPQCQJQAENL-HNNXBMFYSA-N |
| XLogP | 3.43 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |