C27H33NO5S — CID 3997884
[2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate (PubChem CID 3997884) has the molecular formula C27H33NO5S and a molecular weight of 483.63 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 3997884 |
| Molecular Formula | C27H33NO5S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H33NO5S/c29-26(23-15-13-22(14-16-23)21-9-4-3-5-10-21)20-33-27(30)24-11-8-12-25(19-24)34(31,32)28-17-6-1-2-7-18-28/h8,11-16,19,21H,1-7,9-10,17-18,20H2 |
| InChIKey | PFOZVWBPTBPPJF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |