C31H34N2O5S — CID 23991253
[2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 23991253) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 23991253 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C31H34N2O5S/c34-30(26-16-14-25(15-17-26)24-8-3-1-4-9-24)23-38-31(35)27-10-7-13-29(22-27)39(36,37)33-20-18-32(19-21-33)28-11-5-2-6-12-28/h2,5-7,10-17,22,24H,1,3-4,8-9,18-21,23H2 |
| InChIKey | BIVJILVLWKBEJM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |