C26H33N3O5S — CID 16534227
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 16534227) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16534227 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CN(C(=O)COC(=O)c1cccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H33N3O5S/c1-27(22-10-4-2-5-11-22)25(30)20-34-26(31)21-9-8-14-24(19-21)35(32,33)29-17-15-28(16-18-29)23-12-6-3-7-13-23/h3,6-9,12-14,19,22H,2,4-5,10-11,15-18,20H2,1H3 |
| InChIKey | KAPVGESHLNVKNM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |