C25H31N3O5S — CID 41124161
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 41124161) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 41124161 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | C[C@@H]1CCCCN1C(=O)COC(=O)c1cccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H31N3O5S/c1-20-8-5-6-13-28(20)24(29)19-33-25(30)21-9-7-12-23(18-21)34(31,32)27-16-14-26(15-17-27)22-10-3-2-4-11-22/h2-4,7,9-12,18,20H,5-6,8,13-17,19H2,1H3/t20-/m1/s1 |
| InChIKey | KATBRNRPPZHQQX-HXUWFJFHSA-N |
| XLogP | 2.76 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |