C29H33N3O5S — CID 4600943
[2-(2-butan-2-ylanilino)-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 4600943) has the molecular formula C29H33N3O5S and a molecular weight of 535.67 g/mol. Its IUPAC name is [2-(2-butan-2-ylanilino)-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(2-butan-2-ylanilino)-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 4600943 |
| Molecular Formula | C29H33N3O5S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | [2-(2-butan-2-ylanilino)-2-oxoethyl] 3-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CCC(C)c1ccccc1NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C29H33N3O5S/c1-3-22(2)26-14-7-8-15-27(26)30-28(33)21-37-29(34)23-10-9-13-25(20-23)38(35,36)32-18-16-31(17-19-32)24-11-5-4-6-12-24/h4-15,20,22H,3,16-19,21H2,1-2H3,(H,30,33) |
| InChIKey | FAXWZLUCVNMHKX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |