C25H33N3O5S — CID 42971821
[2-(3-methylbutan-2-ylamino)-2-oxoethyl] 3-(4-benzylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 42971821) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 3-(4-benzylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 3-(4-benzylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 42971821 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 3-(4-benzylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CC(C)C(C)NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H33N3O5S/c1-19(2)20(3)26-24(29)18-33-25(30)22-10-7-11-23(16-22)34(31,32)28-14-12-27(13-15-28)17-21-8-5-4-6-9-21/h4-11,16,19-20H,12-15,17-18H2,1-3H3,(H,26,29) |
| InChIKey | OCYLPKFWYOFOKN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |