C26H33N3O5S — CID 42971999
[1-(cyclopentylamino)-1-oxopropan-2-yl] 3-(4-benzylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 42971999) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 3-(4-benzylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 3-(4-benzylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 42971999 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 3-(4-benzylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CC(OC(=O)c1cccc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C26H33N3O5S/c1-20(25(30)27-23-11-5-6-12-23)34-26(31)22-10-7-13-24(18-22)35(32,33)29-16-14-28(15-17-29)19-21-8-3-2-4-9-21/h2-4,7-10,13,18,20,23H,5-6,11-12,14-17,19H2,1H3,(H,27,30) |
| InChIKey | JZAMDMMEVBYVQZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |