C19H25ClN2O5S — CID 55321654
[1-(cyclopentylamino)-1-oxopropan-2-yl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 55321654) has the molecular formula C19H25ClN2O5S and a molecular weight of 428.94 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55321654 |
| Molecular Formula | C19H25ClN2O5S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H25ClN2O5S/c1-13(18(23)21-14-6-2-3-7-14)27-19(24)16-12-15(8-9-17(16)20)28(25,26)22-10-4-5-11-22/h8-9,12-14H,2-7,10-11H2,1H3,(H,21,23) |
| InChIKey | CAGUCZCUFJSPBE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |