C15H19ClN2O5S — CID 2599219
[(2R)-1-amino-1-oxopropan-2-yl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 2599219) has the molecular formula C15H19ClN2O5S and a molecular weight of 374.85 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2599219 |
| Molecular Formula | C15H19ClN2O5S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl)C(N)=O |
| InChI | InChI=1S/C15H19ClN2O5S/c1-10(14(17)19)23-15(20)12-9-11(5-6-13(12)16)24(21,22)18-7-3-2-4-8-18/h5-6,9-10H,2-4,7-8H2,1H3,(H2,17,19)/t10-/m1/s1 |
| InChIKey | GNANYCCJCJIRGE-SNVBAGLBSA-N |
| XLogP | 1.55 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |