C10H11ClN2O5S — CID 22108582
(1-amino-1-oxopropan-2-yl) 2-chloro-5-sulfamoylbenzoate (PubChem CID 22108582) has the molecular formula C10H11ClN2O5S and a molecular weight of 306.73 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 2-chloro-5-sulfamoylbenzoate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 22108582 |
| Molecular Formula | C10H11ClN2O5S |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 2-chloro-5-sulfamoylbenzoate |
| SMILES | CC(OC(=O)c1cc(S(N)(=O)=O)ccc1Cl)C(N)=O |
| InChI | InChI=1S/C10H11ClN2O5S/c1-5(9(12)14)18-10(15)7-4-6(19(13,16)17)2-3-8(7)11/h2-5H,1H3,(H2,12,14)(H2,13,16,17) |
| InChIKey | WQEJAWWZRKCUCE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |