C12H16ClNO5S — CID 103491260
1-ethoxypropan-2-yl 2-chloro-5-sulfamoylbenzoate (PubChem CID 103491260) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 2-chloro-5-sulfamoylbenzoate.
| Compound Name | 1-ethoxypropan-2-yl 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 103491260 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 1-ethoxypropan-2-yl 2-chloro-5-sulfamoylbenzoate |
| SMILES | CCOCC(C)OC(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C12H16ClNO5S/c1-3-18-7-8(2)19-12(15)10-6-9(20(14,16)17)4-5-11(10)13/h4-6,8H,3,7H2,1-2H3,(H2,14,16,17) |
| InChIKey | LIYSOAGQHLCJIS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |