C12H13Cl2FO5S — CID 103491115
1-ethoxypropan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate (PubChem CID 103491115) has the molecular formula C12H13Cl2FO5S and a molecular weight of 359.20 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate.
| Compound Name | 1-ethoxypropan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate |
|---|---|
| PubChem CID | 103491115 |
| Molecular Formula | C12H13Cl2FO5S |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 1-ethoxypropan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate |
| SMILES | CCOCC(C)OC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1Cl |
| InChI | InChI=1S/C12H13Cl2FO5S/c1-3-19-6-7(2)20-12(16)9-4-8(21(14,17)18)5-10(15)11(9)13/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | WTVOPTIVIYDZKX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |