About pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate
pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate (PubChem CID 102988339) has the molecular formula C12H13Cl2FO4S
and a molecular weight of 343.20 g/mol. Its IUPAC name is pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate.
Molecular Properties
| Compound Name | pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate |
| PubChem CID | 102988339 |
| Molecular Formula | C12H13Cl2FO4S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate |
| SMILES | CCCC(C)OC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1Cl |
| InChI | InChI=1S/C12H13Cl2FO4S/c1-3-4-7(2)19-12(16)9-5-8(20(14,17)18)6-10(15)11(9)13/h5-7H,3-4H2,1-2H3 |
| InChIKey | RAJRNYLUFJNLEW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate?
The IUPAC name of pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate (CID 102988339) is pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate.
What is the SMILES notation for pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate?
The canonical SMILES for pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate is CCCC(C)OC(=O)c1cc(S(=O)(=O)Cl)cc(F)c1Cl.
What is the InChIKey of pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate?
The InChIKey is RAJRNYLUFJNLEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2FO4S/c1-3-4-7(2)19-12(16)9-5-8(20(14,17)18)6-10(15)11(9)13/h5-7H,3-4H2,1-2H3.
What are the key properties of pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate?
pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate has a molecular weight of 343.20 g/mol, XLogP of 3.75, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate is sourced from PubChem (CID 102988339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).