cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate

C11H9Cl2FO4S — CID 81454114

IUPACcyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate
SMILESO=C(OC1CCC1)c1cc(S(=O)(=O)Cl)cc(F)c1Cl
InChIInChI=1S/C11H9Cl2FO4S/c12-10-8(11(15)18-6-2-1-3-6)4-7(5-9(10)14)19(13,16)17/h4-6H,1-3H2
InChIKeyNTBGYSYJVSAZOT-UHFFFAOYSA-N
MW327.16 g/mol
LogP3.12
Rot. Bonds3

About cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate

cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate (PubChem CID 81454114) has the molecular formula C11H9Cl2FO4S and a molecular weight of 327.16 g/mol. Its IUPAC name is cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate.

Molecular Properties

Compound Namecyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate
PubChem CID81454114
Molecular FormulaC11H9Cl2FO4S
Molecular Weight327.16 g/mol
Exact Mass325.96
IUPAC Namecyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate
SMILESO=C(OC1CCC1)c1cc(S(=O)(=O)Cl)cc(F)c1Cl
InChIInChI=1S/C11H9Cl2FO4S/c12-10-8(11(15)18-6-2-1-3-6)4-7(5-9(10)14)19(13,16)17/h4-6H,1-3H2
InChIKeyNTBGYSYJVSAZOT-UHFFFAOYSA-N
XLogP3.12
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.16
LogP ≤ 53.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate?
The IUPAC name of cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate (CID 81454114) is cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate.
What is the SMILES notation for cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate?
The canonical SMILES for cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate is O=C(OC1CCC1)c1cc(S(=O)(=O)Cl)cc(F)c1Cl.
What is the InChIKey of cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate?
The InChIKey is NTBGYSYJVSAZOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2FO4S/c12-10-8(11(15)18-6-2-1-3-6)4-7(5-9(10)14)19(13,16)17/h4-6H,1-3H2.
What are the key properties of cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate?
cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate has a molecular weight of 327.16 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl 2-chloro-5-chlorosulfonyl-3-fluorobenzoate is sourced from PubChem (CID 81454114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).