C20H25ClO6S — CID 170992105
dicyclohexyl 5-chlorosulfonylbenzene-1,3-dicarboxylate (PubChem CID 170992105) has the molecular formula C20H25ClO6S and a molecular weight of 428.93 g/mol. Its IUPAC name is dicyclohexyl 5-chlorosulfonylbenzene-1,3-dicarboxylate.
| Compound Name | dicyclohexyl 5-chlorosulfonylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 170992105 |
| Molecular Formula | C20H25ClO6S |
| Molecular Weight | 428.93 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | dicyclohexyl 5-chlorosulfonylbenzene-1,3-dicarboxylate |
| SMILES | O=C(OC1CCCCC1)c1cc(C(=O)OC2CCCCC2)cc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C20H25ClO6S/c21-28(24,25)18-12-14(19(22)26-16-7-3-1-4-8-16)11-15(13-18)20(23)27-17-9-5-2-6-10-17/h11-13,16-17H,1-10H2 |
| InChIKey | BSGJOUOMKUVLLG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |