C13H16ClFO5S — CID 103491146
1-ethoxypropan-2-yl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate (PubChem CID 103491146) has the molecular formula C13H16ClFO5S and a molecular weight of 338.78 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate.
| Compound Name | 1-ethoxypropan-2-yl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 103491146 |
| Molecular Formula | C13H16ClFO5S |
| Molecular Weight | 338.78 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-ethoxypropan-2-yl 5-chlorosulfonyl-2-fluoro-4-methylbenzoate |
| SMILES | CCOCC(C)OC(=O)c1cc(S(=O)(=O)Cl)c(C)cc1F |
| InChI | InChI=1S/C13H16ClFO5S/c1-4-19-7-9(3)20-13(16)10-6-12(21(14,17)18)8(2)5-11(10)15/h5-6,9H,4,7H2,1-3H3 |
| InChIKey | JSQLOMUTNYHSKE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |