C13H18BrNO5S — CID 103491243
1-ethoxypropan-2-yl 3-bromo-2-methyl-5-sulfamoylbenzoate (PubChem CID 103491243) has the molecular formula C13H18BrNO5S and a molecular weight of 380.26 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 3-bromo-2-methyl-5-sulfamoylbenzoate.
| Compound Name | 1-ethoxypropan-2-yl 3-bromo-2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 103491243 |
| Molecular Formula | C13H18BrNO5S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 1-ethoxypropan-2-yl 3-bromo-2-methyl-5-sulfamoylbenzoate |
| SMILES | CCOCC(C)OC(=O)c1cc(S(N)(=O)=O)cc(Br)c1C |
| InChI | InChI=1S/C13H18BrNO5S/c1-4-19-7-8(2)20-13(16)11-5-10(21(15,17)18)6-12(14)9(11)3/h5-6,8H,4,7H2,1-3H3,(H2,15,17,18) |
| InChIKey | RHBNCJNQSTZUTC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |