ethyl 2,3-dimethyl-5-sulfamoylbenzoate

C11H15NO4S — CID 63840159

IUPACethyl 2,3-dimethyl-5-sulfamoylbenzoate
SMILESCCOC(=O)c1cc(S(N)(=O)=O)cc(C)c1C
InChIInChI=1S/C11H15NO4S/c1-4-16-11(13)10-6-9(17(12,14)15)5-7(2)8(10)3/h5-6H,4H2,1-3H3,(H2,12,14,15)
InChIKeyCTMXFFOHDQAVFY-UHFFFAOYSA-N
MW257.31 g/mol
LogP1.13
Rot. Bonds3

About ethyl 2,3-dimethyl-5-sulfamoylbenzoate

ethyl 2,3-dimethyl-5-sulfamoylbenzoate (PubChem CID 63840159) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is ethyl 2,3-dimethyl-5-sulfamoylbenzoate.

Molecular Properties

Compound Nameethyl 2,3-dimethyl-5-sulfamoylbenzoate
PubChem CID63840159
Molecular FormulaC11H15NO4S
Molecular Weight257.31 g/mol
Exact Mass257.07
IUPAC Nameethyl 2,3-dimethyl-5-sulfamoylbenzoate
SMILESCCOC(=O)c1cc(S(N)(=O)=O)cc(C)c1C
InChIInChI=1S/C11H15NO4S/c1-4-16-11(13)10-6-9(17(12,14)15)5-7(2)8(10)3/h5-6H,4H2,1-3H3,(H2,12,14,15)
InChIKeyCTMXFFOHDQAVFY-UHFFFAOYSA-N
XLogP1.13
TPSA86.46 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.31
LogP ≤ 51.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze ethyl 2,3-dimethyl-5-sulfamoylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,3-dimethyl-5-sulfamoylbenzoate?
The IUPAC name of ethyl 2,3-dimethyl-5-sulfamoylbenzoate (CID 63840159) is ethyl 2,3-dimethyl-5-sulfamoylbenzoate.
What is the SMILES notation for ethyl 2,3-dimethyl-5-sulfamoylbenzoate?
The canonical SMILES for ethyl 2,3-dimethyl-5-sulfamoylbenzoate is CCOC(=O)c1cc(S(N)(=O)=O)cc(C)c1C.
What is the InChIKey of ethyl 2,3-dimethyl-5-sulfamoylbenzoate?
The InChIKey is CTMXFFOHDQAVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4S/c1-4-16-11(13)10-6-9(17(12,14)15)5-7(2)8(10)3/h5-6H,4H2,1-3H3,(H2,12,14,15).
What are the key properties of ethyl 2,3-dimethyl-5-sulfamoylbenzoate?
ethyl 2,3-dimethyl-5-sulfamoylbenzoate has a molecular weight of 257.31 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dimethyl-5-sulfamoylbenzoate is sourced from PubChem (CID 63840159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).