C11H15NO4S — CID 63840159
ethyl 2,3-dimethyl-5-sulfamoylbenzoate (PubChem CID 63840159) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is ethyl 2,3-dimethyl-5-sulfamoylbenzoate.
| Compound Name | ethyl 2,3-dimethyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 63840159 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | ethyl 2,3-dimethyl-5-sulfamoylbenzoate |
| SMILES | CCOC(=O)c1cc(S(N)(=O)=O)cc(C)c1C |
| InChI | InChI=1S/C11H15NO4S/c1-4-16-11(13)10-6-9(17(12,14)15)5-7(2)8(10)3/h5-6H,4H2,1-3H3,(H2,12,14,15) |
| InChIKey | CTMXFFOHDQAVFY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |