C14H22N2O4S — CID 65379978
N-(1-methoxybutan-2-yl)-2,3-dimethyl-5-sulfamoylbenzamide (PubChem CID 65379978) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-(1-methoxybutan-2-yl)-2,3-dimethyl-5-sulfamoylbenzamide.
| Compound Name | N-(1-methoxybutan-2-yl)-2,3-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65379978 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-(1-methoxybutan-2-yl)-2,3-dimethyl-5-sulfamoylbenzamide |
| SMILES | CCC(COC)NC(=O)c1cc(S(N)(=O)=O)cc(C)c1C |
| InChI | InChI=1S/C14H22N2O4S/c1-5-11(8-20-4)16-14(17)13-7-12(21(15,18)19)6-9(2)10(13)3/h6-7,11H,5,8H2,1-4H3,(H,16,17)(H2,15,18,19) |
| InChIKey | BYNOMOPLKZGHFG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |