C15H22N2O5S — CID 125135704
methyl (2S)-2-[(2,3-dimethyl-5-sulfamoylbenzoyl)amino]-3-methylbutanoate (PubChem CID 125135704) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl (2S)-2-[(2,3-dimethyl-5-sulfamoylbenzoyl)amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(2,3-dimethyl-5-sulfamoylbenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 125135704 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl (2S)-2-[(2,3-dimethyl-5-sulfamoylbenzoyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1cc(S(N)(=O)=O)cc(C)c1C)C(C)C |
| InChI | InChI=1S/C15H22N2O5S/c1-8(2)13(15(19)22-5)17-14(18)12-7-11(23(16,20)21)6-9(3)10(12)4/h6-8,13H,1-5H3,(H,17,18)(H2,16,20,21)/t13-/m0/s1 |
| InChIKey | OCNDIDJMKCGFFN-ZDUSSCGKSA-N |
| XLogP | 0.88 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |